CAS 32246-20-1
:5-Bromo-2,4-dimethoxybenzoic acid
Description:
5-Bromo-2,4-dimethoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and two methoxy groups attached to a benzoic acid framework. The molecular structure features a benzene ring substituted at the 5-position with a bromine atom and at the 2- and 4-positions with methoxy groups, which are -OCH3 functional groups. This compound is typically a white to off-white solid and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water due to its hydrophobic aromatic structure. The presence of the bromine and methoxy groups can influence its reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Additionally, the compound may exhibit interesting biological activities, which can be explored in medicinal chemistry. Proper handling and storage are essential, as with many chemical substances, to ensure safety and stability.
Formula:C9H9BrO4
InChI:InChI=1/C9H9BrO4/c1-13-7-4-8(14-2)6(10)3-5(7)9(11)12/h3-4H,1-2H3,(H,11,12)
SMILES:COc1cc(c(cc1C(=O)O)Br)OC
Synonyms:- Benzoic Acid, 5-Bromo-2,4-Dimethoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Bromo-2,4-dimethoxybenzoic Acid
CAS:Formula:C9H9BrO4Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:261.075-Bromo-2,4-dimethoxybenzoic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C9H9BrO4Purity:97%Molecular weight:261.075-Bromo-2,4-dimethoxybenzoic acid
CAS:Formula:C9H9BrO4Purity:97%Color and Shape:SolidMolecular weight:261.06945-Bromo-2,4-dimethoxybenzoic acid
CAS:5-Bromo-2,4-dimethoxybenzoic acidPurity:98%Molecular weight:261.07g/mol




