CAS 32251-84-6

3-Methyl-5-(phenylmethyl)-1H-pyrazole

Description:

3-Methyl-5-(phenylmethyl)-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which consists of a five-membered ring containing two nitrogen atoms. This compound features a methyl group at the 3-position and a phenylmethyl group at the 5-position of the pyrazole ring, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in organic solvents. The presence of the phenylmethyl group enhances its hydrophobic characteristics, making it less soluble in water. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with various biological targets, which can be explored in pharmacological studies. As with many pyrazole derivatives, it may also possess interesting properties such as anti-inflammatory or analgesic effects, although specific biological activities would need to be confirmed through experimental research. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₁H₁₂N₂

InChI: InChI=1S/C11H12N2/c1-9-7-11(13-12-9)8-10-5-3-2-4-6-10/h2-7H,8H2,1H3,(H,12,13)

InChI key: InChIKey=PJIZWLQFZIGTTD-UHFFFAOYSA-N

SMILES: C(C=1NN=C(C)C1)C2=CC=CC=C2

Synonyms:

• 1H-Pyrazole, 3-methyl-5-(phenylmethyl)-
• 3-Methyl-5-(phenylmethyl)-1H-pyrazole
• 3-Benzyl-5-methyl-1H-pyrazole
• 3-Benzyl-5-methylpyrazole