CAS 32261-88-4

3-(4-ethoxyphenyl)-2-thioxoimidazolidin-4-one

Description:

3-(4-Ethoxyphenyl)-2-thioxoimidazolidin-4-one, identified by its CAS number 32261-88-4, is a chemical compound that belongs to the class of imidazolidinones. This substance features a thioxo group, which contributes to its reactivity and potential biological activity. The presence of the ethoxyphenyl group suggests that it may exhibit interesting electronic properties and hydrophobic characteristics, which can influence its solubility and interaction with biological systems. Typically, compounds of this nature may be investigated for their pharmacological properties, including antimicrobial or anti-inflammatory activities. The imidazolidinone core structure is known for its versatility in medicinal chemistry, often serving as a scaffold for drug development. Additionally, the thioxo moiety can enhance the compound's ability to form coordination complexes with metal ions, potentially leading to applications in catalysis or materials science. Overall, the unique structural features of this compound make it a subject of interest in various fields, including medicinal chemistry and materials science.

Formula: C₁₁H₁₂N₂O₂S

InChI: InChI=1/C11H12N2O2S/c1-2-15-9-5-3-8(4-6-9)13-10(14)7-12-11(13)16/h3-6H,2,7H2,1H3,(H,12,16)

InChI key: WCPYYANHAHKFBP-UHFFFAOYSA-N

SMILES: CCOc1ccc(cc1)N1C(=O)CN=C1S

Synonyms:

• 3-(4-ethoxyphenyl)-2-mercapto-3,5-dihydro-4H-imidazol-4-one
• 4-Imidazolidinone, 3-(4-Ethoxyphenyl)-2-Thioxo-