CAS 32262-98-9

2,3-Dimethyl-5-propylpyrazine

Description:

2,3-Dimethyl-5-propylpyrazine is an organic compound belonging to the pyrazine family, characterized by its distinct aromatic properties. It features a pyrazine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms at non-adjacent positions. The presence of two methyl groups at the 2 and 3 positions, along with a propyl group at the 5 position, contributes to its unique chemical behavior and potential applications. This compound is typically colorless to pale yellow and has a strong, nutty, and roasted aroma, making it of interest in the flavor and fragrance industry. It is soluble in organic solvents and exhibits moderate stability under standard conditions. The compound's structure allows for various interactions, including hydrogen bonding and Van der Waals forces, which can influence its reactivity and interactions with other substances. Due to its specific characteristics, 2,3-Dimethyl-5-propylpyrazine may be utilized in food flavoring, perfumery, and potentially in research applications related to organic synthesis and material science.

Formula: C₉H₁₄N₂

InChI: InChI=1S/C9H14N2/c1-4-5-9-6-10-7(2)8(3)11-9/h6H,4-5H2,1-3H3

InChI key: InChIKey=RHCYSZMTNWMCOO-UHFFFAOYSA-N

SMILES: C(CC)C1=NC(C)=C(C)N=C1

Synonyms:

• 2,3-Dimethyl-5-propylpyrazine
• Pyrazine, 2,3-dimethyl-5-propyl-