CAS 32263-71-1

2-Bromo-3,4-dihydro-6-(phenylmethoxy)-1(2H)-naphthalenone

Description:

2-Bromo-3,4-dihydro-6-(phenylmethoxy)-1(2H)-naphthalenone, with the CAS number 32263-71-1, is an organic compound characterized by its complex structure that includes a naphthalene core substituted with a bromine atom and a phenylmethoxy group. This compound typically exhibits properties associated with naphthalene derivatives, such as being relatively hydrophobic due to its polycyclic aromatic structure. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and polarity. The phenylmethoxy group enhances its potential for interactions with biological systems, making it of interest in medicinal chemistry. Additionally, the compound may display specific optical properties, such as fluorescence, depending on its electronic structure. Its synthesis and reactivity can be influenced by the presence of the bromine and methoxy groups, making it a versatile intermediate in organic synthesis. Overall, this compound's unique structural features contribute to its potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₇H₁₅BrO₂

InChI: InChI=1S/C17H15BrO2/c18-16-9-6-13-10-14(7-8-15(13)17(16)19)20-11-12-4-2-1-3-5-12/h1-5,7-8,10,16H,6,9,11H2

InChI key: InChIKey=KPTXUECFDSOIBD-UHFFFAOYSA-N

SMILES: O=C1C=2C(=CC(OCC3=CC=CC=C3)=CC2)CCC1Br

Synonyms:

• 1(2H)-Naphthalenone, 2-bromo-3,4-dihydro-6-(phenylmethoxy)-
• 2-Bromo-3,4-dihydro-6-(phenylmethoxy)-1(2H)-naphthalenone
• 2-Bromo-6-phenylmethoxy-3,4-dihydro-2H-naphthalen-1-one
• 1(2H)-Naphthalenone, 6-(benzyloxy)-2-bromo-3,4-dihydro-