CAS 322640-05-1: bromo-(3,5-dimethoxyphenyl)magnesium

Description:Bromo-(3,5-dimethoxyphenyl)magnesium is an organomagnesium compound, specifically a Grignard reagent, characterized by the presence of a magnesium atom bonded to a bromo-substituted aromatic ring. This compound features a 3,5-dimethoxyphenyl group, which enhances its reactivity due to the electron-donating effects of the methoxy groups. Grignard reagents are known for their nucleophilic properties, making them valuable in organic synthesis for forming carbon-carbon bonds. The presence of the bromine atom allows for the potential substitution reactions, while the magnesium atom facilitates the formation of new organic compounds through reactions with various electrophiles. Typically, Grignard reagents are sensitive to moisture and air, requiring an anhydrous environment for stability and reactivity. They are commonly used in the synthesis of alcohols, ketones, and other functionalized organic molecules. The specific characteristics of bromo-(3,5-dimethoxyphenyl)magnesium, including its reactivity and stability, make it a useful intermediate in synthetic organic chemistry.

Formula:C₈H₉BrMgO₂

InChI:InChI=1/C8H9O2.BrH.Mg/c1-9-7-4-3-5-8(6-7)10-2;;/h4-6H,1-2H3;1H;/q;;+1/p-1/rC8H9BrMgO2/c1-11-7-3-6(10-9)4-8(5-7)12-2/h3-5H,1-2H3