CAS 322691-19-0

2-Pyridinamine, 5-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-

Description:

2-Pyridinamine, 5-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]- is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of the amine group (-NH2) at the second position of the pyridine contributes to its basicity and potential reactivity in various chemical reactions. The compound also features a silyl ether functional group, which includes a dimethylsilyl moiety, enhancing its stability and solubility in organic solvents. The tert-butyl group attached to the silyl ether provides steric hindrance, which can influence the compound's reactivity and interactions with other molecules. This compound may be of interest in organic synthesis, medicinal chemistry, or materials science due to its unique structural features. Its specific properties, such as boiling point, melting point, and solubility, would depend on the molecular interactions and the environment in which it is used. As with many nitrogen-containing compounds, it may exhibit biological activity, warranting further investigation for potential applications.

Formula: C₁₂H₂₂N₂OSi

InChI: InChI=1S/C12H22N2OSi/c1-12(2,3)16(4,5)15-9-10-6-7-11(13)14-8-10/h6-8H,9H2,1-5H3,(H2,13,14)

InChI key: APPUPAGIHJFPQP-UHFFFAOYSA-N

SMILES: CC(C)(C)[Si](C)(C)OCC1=CN=C(C=C1)N