CymitQuimica logo

CAS 32272-48-3

:

4-Ethyl-2-methylthiazole

Description:
4-Ethyl-2-methylthiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features an ethyl group and a methyl group attached to the thiazole ring, contributing to its unique properties. It is typically a colorless to pale yellow liquid with a distinctive odor, often described as nutty or roasted. The molecular formula of 4-Ethyl-2-methylthiazole reflects its composition, and it is known for its role in various chemical reactions and applications, particularly in the flavor and fragrance industry. Additionally, it may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility characteristics generally indicate that it is soluble in organic solvents but may have limited solubility in water. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 4-Ethyl-2-methylthiazole is a compound of interest due to its structural features and potential applications.
Formula:C6H9NS
InChI:InChI=1S/C6H9NS/c1-3-6-4-8-5(2)7-6/h4H,3H2,1-2H3
InChI key:InChIKey=JEEOZKGYSUUAAU-UHFFFAOYSA-N
SMILES:C(C)C=1N=C(C)SC1
Synonyms:
  • 2-Methyl-4-ethylthiazole
  • 4-Ethyl-2-methylthiazole
  • Thiazole, 4-ethyl-2-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.