CAS 32278-54-9

5H-Thiazolo[3,2-a]pyrimidin-5-one

Description:

5H-Thiazolo[3,2-a]pyrimidin-5-one is a heterocyclic compound characterized by a fused thiazole and pyrimidine ring system. This compound features a five-membered thiazole ring containing sulfur and nitrogen atoms, which contributes to its unique chemical properties. The pyrimidine portion of the molecule is a six-membered ring with two nitrogen atoms, enhancing its potential for biological activity. The presence of the carbonyl group (C=O) at the 5-position of the pyrimidine ring is significant for its reactivity and interactions with biological targets. This compound is of interest in medicinal chemistry due to its potential pharmacological applications, including antimicrobial and anticancer activities. Its structural features allow for various modifications, which can lead to derivatives with enhanced efficacy or selectivity. Additionally, the compound's solubility and stability can vary based on the substituents attached to the ring system, influencing its behavior in biological systems and its utility in drug development. Overall, 5H-Thiazolo[3,2-a]pyrimidin-5-one represents a valuable scaffold in the search for novel therapeutic agents.

Formula: C₆H₄N₂OS

InChI: InChI=1S/C6H4N2OS/c9-5-1-2-7-6-8(5)3-4-10-6/h1-4H

InChI key: InChIKey=UEZROEGYRDHMRV-UHFFFAOYSA-N

SMILES: O=C1N2C(=NC=C1)SC=C2

Synonyms:

• [1,3]Thiazolo[3,2-a]pyrimidin-5-one
• 5H-Thiazolo[3,2-a]pyrimidin-5-one
• NSC 607397