CAS 32280-53-8

N,N'-[(4,6-dimethylbenzene-1,3-diyl)dimethanediyl]diacetamide

Description:

N,N'-[(4,6-dimethylbenzene-1,3-diyl)dimethanediyl]diacetamide, with the CAS number 32280-53-8, is an organic compound characterized by its amide functional groups and a central structure derived from a dimethyl-substituted benzene. This compound features two acetamide groups attached to a dimethanediyl bridge, which connects the aromatic rings. The presence of the dimethyl groups on the benzene ring contributes to its steric properties and may influence its solubility and reactivity. Typically, compounds of this nature exhibit moderate polarity due to the amide linkages, which can engage in hydrogen bonding. The molecular structure suggests potential applications in pharmaceuticals or materials science, particularly in areas requiring specific interactions or modifications of physical properties. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the methyl groups and the overall molecular geometry. As with many organic compounds, safety and handling precautions should be observed, particularly regarding potential toxicity or environmental impact.

Formula: C₁₄H₂₀N₂O₂

InChI: InChI=1/C14H20N2O2/c1-9-5-10(2)14(8-16-12(4)18)6-13(9)7-15-11(3)17/h5-6H,7-8H2,1-4H3,(H,15,17)(H,16,18)

InChI key: OBHHXCJJZMCBMO-UHFFFAOYSA-N

SMILES: Cc1cc(C)c(cc1CN=C(C)O)CN=C(C)O

Synonyms:

• acetamide, N,N'-[(4,6-dimethyl-1,3-phenylene)bis(methylene)]bis-
• N,N'-[(4,6-Dimethyl-1,3-phenylene)bis(methylene)]diacetamide
• N,N'-[(4,6-Dimethyl-m-phenylene)dimethylene]bis-acetamide