CAS 32281-99-5

7-Bromo-3,4-dihydro-2-methyl-1(2H)-naphthalenone

Description:

7-Bromo-3,4-dihydro-2-methyl-1(2H)-naphthalenone is an organic compound characterized by its naphthalene structure, which features a bromine substituent and a ketone functional group. The presence of the bromine atom at the 7-position contributes to its reactivity and potential applications in organic synthesis. The compound also contains a dihydro group, indicating that it has two hydrogen atoms added to the naphthalene ring, which can influence its physical properties and reactivity. The methyl group at the 2-position further modifies its chemical behavior. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and materials science, due to its unique structural features that may impart specific biological or chemical properties. Its molecular structure suggests potential for various reactions, including electrophilic substitutions and nucleophilic additions, making it a valuable intermediate in synthetic organic chemistry. Safety data and handling precautions should be observed, as with all brominated compounds, due to potential toxicity and environmental concerns.

Formula: C₁₁H₁₁BrO

InChI: InChI=1S/C11H11BrO/c1-7-2-3-8-4-5-9(12)6-10(8)11(7)13/h4-7H,2-3H2,1H3

InChI key: InChIKey=UDPZWJLBZDWBNI-UHFFFAOYSA-N

SMILES: O=C1C=2C(CCC1C)=CC=C(Br)C2

Synonyms:

• 7-Bromo-2-methyl-3,4-dihydronaphthalen-1(2H)-one
• 7-Bromo-3,4-dihydro-2-methyl-1(2H)-naphthalenone
• 1(2H)-Naphthalenone, 7-bromo-3,4-dihydro-2-methyl-
• 7-Bromo-2-methyl-3,4-dihydro-2H-naphthalen-1-one