CAS 32282-06-7
:N~2~-ethylpyridine-2,3-diamine
Description:
N~2~-ethylpyridine-2,3-diamine, with the CAS number 32282-06-7, is an organic compound characterized by its pyridine ring structure substituted with an ethyl group and two amino groups at the 2 and 3 positions. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the ethyl group enhances its hydrophobic character compared to other pyridine derivatives. N~2~-ethylpyridine-2,3-diamine may participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions, making it of interest in coordination chemistry and organic synthesis. Its biological activity can also be significant, as amine-containing compounds often exhibit various pharmacological properties. Safety data should be consulted for handling, as amines can be irritants and may pose health risks. Overall, this compound's unique structure and functional groups contribute to its potential applications in research and industry.
Formula:C7H11N3
InChI:InChI=1/C7H11N3/c1-2-9-7-6(8)4-3-5-10-7/h3-5H,2,8H2,1H3,(H,9,10)
SMILES:CCNc1c(cccn1)N
Synonyms:- 2,3-pyridinediamine, N~2~-ethyl-
- 2-Ethylamino-3-aminopyridine
- 32282-06-7
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-N-Ethylpyridine-2,3-diamine
CAS:<p>2-N-Ethylpyridine-2,3-diamine is a small molecule inhibitor that binds to the ATP binding site of HIV reverse transcriptase and inhibits its activity. It has been shown to inhibit the proliferation of human tumor cells in culture. This compound also prevents the formation of new virus particles and leads to a decrease in viral load. 2-N-Ethylpyridine-2,3-diamine does not bind to the same site as nevirapine, but instead binds to a different amino acid residue on the reverse transcriptase enzyme called Y181C. Residues at this location are found in all HIV strains resistant to nevirapine.</p>Formula:C7H11N3Purity:Min. 95%Molecular weight:137.18 g/mol
