CAS 32282-18-1

3-Ethyl-3H-imidazo[4,5-b]pyridine-2-methanol

Description:

3-Ethyl-3H-imidazo[4,5-b]pyridine-2-methanol is a heterocyclic organic compound characterized by its imidazo-pyridine structure, which incorporates both nitrogen and carbon atoms in its ring system. This compound features an ethyl group at the 3-position and a hydroxymethyl group at the 2-position of the imidazo ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydroxymethyl group, which can engage in hydrogen bonding. The compound may display biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure allows for potential interactions with biological targets, and it may undergo various chemical reactions, including oxidation and substitution, depending on the conditions. As with many heterocycles, its reactivity and stability can be influenced by the presence of functional groups and the electronic environment of the nitrogen atoms in the ring.

Formula: C₉H₁₁N₃O

InChI: InChI=1S/C9H11N3O/c1-2-12-8(6-13)11-7-4-3-5-10-9(7)12/h3-5,13H,2,6H2,1H3

InChI key: InChIKey=CHCSPLGUESFDJR-UHFFFAOYSA-N

SMILES: C(C)N1C=2C(N=C1CO)=CC=CN2

Synonyms:

• [3-Ethyl-3H-imidazo[4,5-b]pyridin-2-yl]methanol
• 3-Ethyl-3H-imidazo[4,5-b]pyridine-2-methanol
• 3H-Imidazo[4,5-b]pyridine-2-methanol, 3-ethyl-