CAS 32293-42-8

4-(Phenylmethoxy)-N-(phenylmethyl)benzeneethanamine

Description:

4-(Phenylmethoxy)-N-(phenylmethyl)benzeneethanamine, identified by its CAS number 32293-42-8, is a chemical compound that belongs to the class of amines. This substance features a complex structure characterized by a benzene ring substituted with both a phenylmethoxy group and a phenylmethyl group, which contributes to its unique properties. The presence of the amine functional group suggests potential basicity and reactivity, particularly in forming salts or participating in nucleophilic reactions. The compound's aromatic rings may impart stability and influence its solubility in organic solvents. Additionally, the presence of multiple phenyl groups can enhance its hydrophobic characteristics, potentially affecting its biological activity and interactions with other molecules. While specific applications or biological activities may vary, compounds of this nature are often explored in medicinal chemistry for their potential therapeutic effects. As with any chemical substance, safety data and handling precautions should be consulted to ensure proper usage and risk management.

Formula: C₂₂H₂₃NO

InChI: InChI=1S/C22H23NO/c1-3-7-20(8-4-1)17-23-16-15-19-11-13-22(14-12-19)24-18-21-9-5-2-6-10-21/h1-14,23H,15-18H2

InChI key: InChIKey=XBGMECOKYONDPM-UHFFFAOYSA-N

SMILES: O(CC1=CC=CC=C1)C2=CC=C(CCNCC3=CC=CC=C3)C=C2

Synonyms:

• Benzeneethanamine, 4-(phenylmethoxy)-N-(phenylmethyl)-
• 4-(Phenylmethoxy)-N-(phenylmethyl)benzeneethanamine
• Phenethylamine, N-benzyl-p-(benzyloxy)-