CAS 32298-28-5

2-Naphthalenecarboxylicacid, 1,2,3,4,5,6,7,8-octahydro-

Description:

2-Naphthalenecarboxylic acid, 1,2,3,4,5,6,7,8-octahydro- is a chemical compound characterized by its naphthalene backbone, which is a polycyclic aromatic hydrocarbon. This compound features a carboxylic acid functional group (-COOH) attached to a saturated naphthalene structure, indicating that it has undergone hydrogenation to achieve its octahydro form. The presence of the carboxylic acid group suggests that it can participate in acid-base reactions and may act as a weak acid. Its structure contributes to its potential applications in organic synthesis and as an intermediate in the production of various chemical compounds. The compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to its hydrophobic naphthalene core. Additionally, it may possess interesting biological activities, making it a subject of interest in medicinal chemistry. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₁H₁₆O₂

InChI: InChI=1S/C11H16O2/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h10H,1-7H2,(H,12,13)

InChI key: FLDNUKAJQPKKMD-UHFFFAOYSA-N

SMILES: C1CCC2=C(C1)CCC(C2)C(=O)O

Synonyms:

• 1,2,3,4,5,6,7,8-Octahydro-2-naphthalenecarboxylic acid
• 2-Naphthoicacid, 1,2,3,4,5,6,7,8-octahydro- (6CI)