CAS 323-60-4

NN-Bis(2-hydroxyethyl)-m-fluoroaniline

Description:

NN-Bis(2-hydroxyethyl)-m-fluoroaniline, with the CAS number 323-60-4, is an organic compound characterized by its amine functional groups and the presence of a fluorine atom on the aromatic ring. This substance typically appears as a solid or viscous liquid, depending on its purity and temperature. It is soluble in polar solvents such as water and alcohols due to the hydroxyl groups, which enhance its hydrophilicity. The compound is often used in various applications, including as a chemical intermediate in the synthesis of dyes, pharmaceuticals, and agrochemicals. Its structure allows for potential reactivity in nucleophilic substitution reactions, particularly due to the electron-withdrawing effect of the fluorine atom, which can influence the compound's reactivity and stability. Safety considerations should be taken into account, as it may pose health risks if inhaled or ingested, and appropriate handling procedures should be followed to mitigate exposure. Overall, NN-Bis(2-hydroxyethyl)-m-fluoroaniline is a versatile compound with significant industrial relevance.

Formula: C₁₀H₁₄FNO₂

InChI: InChI=1/C10H14FNO2/c11-9-2-1-3-10(8-9)12(4-6-13)5-7-14/h1-3,8,13-14H,4-7H2

InChI key: GFXQBWUWIQBIKN-UHFFFAOYSA-N

SMILES: c1cc(cc(c1)N(CCO)CCO)F

Synonyms:

• 2,2-[(3-Fluorophenyl)imino]diethanol