CAS 32318-29-9

Tris(diethylamino)-difluoro-phosphorane

Description:

Tris(diethylamino)-difluoro-phosphorane, with the CAS number 32318-29-9, is a phosphorus-containing compound characterized by its unique structure and reactivity. It features a central phosphorus atom bonded to two fluorine atoms and three diethylamino groups, which significantly influence its chemical properties. This compound is typically a colorless to pale yellow liquid and is known for its high reactivity, particularly in nucleophilic reactions due to the presence of the electron-donating diethylamino groups. The difluorophosphorane moiety contributes to its stability and reactivity, making it a useful intermediate in organic synthesis and in the preparation of various phosphorus-containing compounds. Additionally, it exhibits properties typical of phosphoranes, such as the ability to act as a strong Lewis base. Due to its chemical nature, handling this compound requires caution, as it may be sensitive to moisture and air, leading to potential hydrolysis or decomposition. Overall, tris(diethylamino)-difluoro-phosphorane is a significant compound in the field of organophosphorus chemistry.

Formula: C₁₂H₃₀F₂N₃P

InChI: InChI=1/C12H30F2N3P/c1-7-15(8-2)18(13,14,16(9-3)10-4)17(11-5)12-6/h7-12H2,1-6H3

InChI key: ISOLTNUEIBNNDO-UHFFFAOYSA-N

SMILES: CCN(CC)P(F)(F)(N(CC)CC)N(CC)CC

Synonyms:

• N,N',N''-(difluoro-lambda~5~-phosphanetriyl)tris(N-ethylethanamine)