CAS 323194-76-9
:L-Aspartic acid monosodium salt monohydrate
Description:
L-Aspartic acid monosodium salt monohydrate is a sodium salt of L-aspartic acid, an amino acid that plays a crucial role in various biological processes. This compound is typically found as a white crystalline powder and is highly soluble in water, making it suitable for various applications in biochemistry and nutrition. It has a molecular formula that reflects the presence of both sodium and water molecules, indicating its hydrated nature. The substance is often used as a dietary supplement, particularly in sports nutrition, due to its potential role in energy metabolism and neurotransmitter function. Additionally, it may serve as a flavor enhancer in food products. L-Aspartic acid monosodium salt monohydrate is generally recognized as safe when used appropriately, but like any substance, it should be handled with care, adhering to safety guidelines. Its stability and reactivity are influenced by environmental factors such as pH and temperature, which are important considerations in its storage and application.
Formula:C4H8NNaO5
InChI:InChI=1/C4H7NO4.Na.H2O/c5-2(4(8)9)1-3(6)7;;/h2H,1,5H2,(H,6,7)(H,8,9);;1H2/q;+1;/p-1/t2-;;/m0../s1
Synonyms:- L-aspartic acid, sodium salt, hydrate (1:1:1)
- Sodium (2S)-2-amino-3-carboxypropanoate hydrate (1:1:1)
- sodium (2S)-2-amino-3-carboxypropanoate hydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
L-Aspartic acid monosodium salt monohydrate, 99%
CAS:<p>L-Aspartic acid monosodium salt monohydrate is used as a principal neurotransmitter for fast synaptic excitation. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The origi</p>Formula:C4H8NNaO5Purity:99%Color and Shape:Powder or crystalline powder, WhiteMolecular weight:173.10L-Aspartic acid sodium salt monohydrate
CAS:Formula:C4H8NNaO5Purity:97%Color and Shape:SolidMolecular weight:173.0998L-Aspartic acid sodium salt monohydrate
CAS:Formula:C4H6NNaO4·H2OPurity:(Titration) 98.5 - 101.5 %Color and Shape:White to almost white crystalline powder or colourless crystalsMolecular weight:173.11Sodium (S)-3-Amino-3-Carboxypropanoate Hydrate
CAS:Sodium (S)-3-Amino-3-Carboxypropanoate HydrateFormula:C4H8NNaO5Purity:98%Molecular weight:173.10g/molL-Aspartic acid sodium salt monohydrate
CAS:<p>L-Aspartic acid sodium salt monohydrate is a sodium carbonate salt of L-aspartic acid that has been shown to inhibit the growth of leishmania in vitro. It may also be effective against other protozoa and amoeba, including Entamoeba histolytica and Naegleria fowleri. L-Aspartic acid sodium salt monohydrate inhibits acid formation by inhibiting the enzyme carbonate synthetase. This compound also has potential as a drug target for infantile lysosomal storage disease due to its ability to activate glutamate, which is an amino acid that is deficient in this condition. The surface methodology used for this study was titration calorimetry, which can be used to measure the thermodynamic properties of activated carboxylates.</p>Formula:C4H6NO4Na·H2OColor and Shape:White Off-White Clear LiquidMolecular weight:173.1 g/molL-Aspartate sodium salt monohydrate
CAS:L-Aspartate sodium salt monohydrate is a chemical that can be used as a reagent, building block, or intermediate in the synthesis of complex compounds. L-Aspartate sodium salt monohydrate is an organic compound that has been used as a reaction component in various research and industrial applications. This chemical is also known to be useful for the synthesis of pharmaceuticals, herbicides, and pesticides. L-Aspartate sodium salt monohydrate has CAS number 323194-76-9.Formula:C4H8NNaO5Molecular weight:173.10 g/molL-Aspartic Acid Sodium Salt Monohydrate
CAS:Controlled Product<p>Applications L-Aspartic acid sodium salt monohydrate (cas# 323194-76-9) is a useful research chemical.<br></p>Formula:C4H6NO4Na·H2OColor and Shape:White To Off-WhiteMolecular weight:155.08 + 18.02
