CAS 3232-26-6

6-Butyl-1,3,5-triazine-2,4-diamine

Description:

6-Butyl-1,3,5-triazine-2,4-diamine, with the CAS number 3232-26-6, is an organic compound characterized by its triazine ring structure, which consists of three nitrogen atoms and three carbon atoms. This compound features butyl groups and amino substituents, contributing to its chemical reactivity and potential applications. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of amino groups. The triazine core is known for its stability and ability to participate in various chemical reactions, making it useful in agricultural chemistry, particularly as a herbicide or in the synthesis of other organic compounds. Additionally, the presence of the butyl group can influence its lipophilicity and biological activity. Safety data should be consulted for handling and exposure, as with any chemical substance, to ensure proper precautions are taken. Overall, 6-Butyl-1,3,5-triazine-2,4-diamine is a compound of interest in both research and industrial applications.

Formula: C₇H₁₃N₅

InChI: InChI=1S/C7H13N5/c1-2-3-4-5-10-6(8)12-7(9)11-5/h2-4H2,1H3,(H4,8,9,10,11,12)

InChI key: InChIKey=FMKJZXVUCJWIIV-UHFFFAOYSA-N

SMILES: C(CCC)C=1N=C(N)N=C(N)N1

Synonyms:

• 6-Butyl-1,3,5-triazine-2,4-diamine
• 1,3,5-Triazine-2,4-diamine, 6-butyl-
• 6-Butyl-2,4-diamino-s-triazine
• s-Triazine, 2,4-diamino-6-butyl-
• 6-Butylguanamine