CAS 32328-67-9
:chloro-dimethyl-(4-phenylbutyl)silane
Description:
Chloro-dimethyl-(4-phenylbutyl)silane, with the CAS number 32328-67-9, is an organosilicon compound characterized by the presence of a silicon atom bonded to two methyl groups, a chloro group, and a 4-phenylbutyl group. This compound typically exhibits a clear to pale yellow liquid form at room temperature and is soluble in organic solvents such as dichloromethane and toluene, but is generally insoluble in water due to its hydrophobic nature. The presence of the chloro group makes it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Its structure suggests that it may have applications in organic synthesis, particularly in the development of silane-based materials or as a coupling agent in polymer chemistry. Additionally, the phenyl group can impart unique electronic properties, making it useful in the design of functional materials. As with many organosilicon compounds, safety precautions should be taken when handling this substance, as it may pose health risks if inhaled or ingested.
Formula:C12H19ClSi
InChI:InChI=1/C12H19ClSi/c1-14(2,13)11-7-6-10-12-8-4-3-5-9-12/h3-5,8-9H,6-7,10-11H2,1-2H3
InChI key:SRTCQNMBBTZICB-UHFFFAOYSA-N
SMILES:C[Si](C)(CCCCc1ccccc1)Cl
Synonyms:- Benzene, [4-(chlorodimethylsilyl)butyl]-
- 4-Phenylbutyldimethylchlorosilane
- Chloro(dimethyl)(4-phenylbutyl)silane
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery