CAS 3233-59-8

Phenol, 2-methoxy-, 1-(hydrogen sulfate)

Description:

Phenol, 2-methoxy-, 1-(hydrogen sulfate), commonly known as methyl 2-methoxyphenyl sulfate, is an organic compound characterized by the presence of a methoxy group (-OCH₃) and a hydrogen sulfate group (-OSO₃H) attached to a phenolic structure. This compound typically appears as a colorless to pale yellow liquid and is soluble in water due to the polar nature of the sulfate group. It exhibits acidic properties, primarily due to the hydrogen sulfate moiety, which can dissociate in solution to release protons. The presence of the methoxy group influences its reactivity, making it a potential substrate for electrophilic aromatic substitution reactions. Additionally, this compound can be involved in various chemical processes, including sulfonation and esterification reactions. Safety considerations should be taken into account, as it may be irritating to the skin and eyes, and proper handling procedures should be followed in laboratory settings. Overall, its unique functional groups contribute to its utility in organic synthesis and potential applications in pharmaceuticals and agrochemicals.

Formula: C₇H₈O₅S

InChI: InChI=1S/C7H8O5S/c1-11-6-4-2-3-5-7(6)12-13(8,9)10/h2-5H,1H3,(H,8,9,10)

InChI key: InChIKey=AQTYXAPIHMXAAV-UHFFFAOYSA-N

SMILES: O(S(=O)(=O)O)C1=C(OC)C=CC=C1

Synonyms:

• o-Methoxyphenyl sulfate
• Phenol, 2-methoxy-, 1-(hydrogen sulfate)
• Phenol, 2-methoxy-, hydrogen sulfate
• 2-Methoxyphenyl sulfate
• Phenol, o-methoxy-, hydrogen sulfate