CAS 3233-90-7
:10,16-Dihydroxyhexadecanoic acid
Description:
10,16-Dihydroxyhexadecanoic acid, also known as a fatty acid derivative, is characterized by the presence of two hydroxyl (-OH) groups located at the 10th and 16th carbon positions of a hexadecanoic acid (palmitic acid) backbone. This compound is a white to off-white solid at room temperature and is soluble in organic solvents, while its solubility in water is limited due to its long hydrophobic carbon chain. The hydroxyl groups contribute to its potential as a surfactant and emulsifying agent, enhancing its utility in various applications, including cosmetics, pharmaceuticals, and food products. The presence of multiple functional groups allows for increased reactivity, making it suitable for further chemical modifications. Additionally, its unique structure may impart specific biological activities, which could be of interest in research related to lipid metabolism or antimicrobial properties. Overall, 10,16-dihydroxyhexadecanoic acid is a versatile compound with potential applications across multiple fields.
Formula:C16H32O4
InChI:InChI=1S/C16H32O4/c17-14-10-6-5-8-12-15(18)11-7-3-1-2-4-9-13-16(19)20/h15,17-18H,1-14H2,(H,19,20)
InChI key:InChIKey=VJZBXAQGWLMYMS-UHFFFAOYSA-N
SMILES:C(C(CCCCCCO)O)CCCCCCCC(O)=O
Synonyms:- 10,16-Dihydroxypalmitic acid
- Hexadecanoic Acid, 10,16-Dihydroxy-
- 10,16-Dihydroxyhexadecanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
10,16-Dihydroxyhexadecanoic Acid
CAS:Controlled ProductApplications 10,16-Dihydroxyhexadecanoic Acid is a component of cutin found in trees.
References Hernandez Velasco, Brenda L., et al.: Phytochemistry, 144, 78-86 (2017);Yang, Weili, et al.: Phytochemistry, 130, 159-169 (2016)Formula:C16H32O4Color and Shape:Off-WhiteMolecular weight:288.423
