CymitQuimica logo

CAS 32337-96-5

:

1-Bromo-2-iodo-3-nitrobenzene

Description:
1-Bromo-2-iodo-3-nitrobenzene is an aromatic compound characterized by the presence of three distinct substituents on a benzene ring: a bromine atom, an iodine atom, and a nitro group. This compound is typically a yellow to brown solid at room temperature and is known for its moderate solubility in organic solvents such as dichloromethane and ether, while being less soluble in water due to its hydrophobic nature. The presence of both halogens (bromine and iodine) and a nitro group contributes to its reactivity, making it a useful intermediate in organic synthesis, particularly in the preparation of more complex molecules. The nitro group is a strong electron-withdrawing group, which can influence the reactivity of the aromatic ring, making it more susceptible to electrophilic substitution reactions. Additionally, the compound may exhibit specific physical properties such as melting and boiling points that are influenced by the interactions between the substituents and the benzene ring. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of halogens and the nitro group.
Formula:C6H3BrINO2
InChI:InChI=1S/C6H3BrINO2/c7-4-2-1-3-5(6(4)8)9(10)11/h1-3H
InChI key:InChIKey=BJOZUBWLKNXFFK-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(I)C(Br)=CC=C1
Synonyms:
  • 3-Bromo-2-iodonitrobenzene
  • Benzene, 1-bromo-2-iodo-3-nitro-
  • 1-Bromo-2-iodo-3-nitrobenzene
Found 4 products.