CAS 32349-98-7

Ethyl 3,3,5-trimethylcyclohexaneacetate

Description:

Ethyl 3,3,5-trimethylcyclohexaneacetate is an organic compound characterized by its ester functional group, which is formed from the reaction of an alcohol and a carboxylic acid. This compound features a cyclohexane ring that is substituted with three methyl groups at the 3 and 5 positions, contributing to its branched structure and potentially influencing its physical properties, such as boiling point and solubility. The ethyl acetate moiety provides a degree of volatility and can enhance its solubility in organic solvents. Typically, compounds like this may exhibit a pleasant, fruity odor, making them useful in flavoring and fragrance applications. The presence of multiple methyl groups can also affect the compound's reactivity and stability, often making it less reactive than simpler esters. Additionally, due to its structural complexity, it may have specific applications in organic synthesis or as an intermediate in the production of other chemical substances. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₃H₂₄O₂

InChI: InChI=1S/C13H24O2/c1-5-15-12(14)7-11-6-10(2)8-13(3,4)9-11/h10-11H,5-9H2,1-4H3

InChI key: InChIKey=IETOGGAMSCXJPG-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)C1CC(C)(C)CC(C)C1

Synonyms:

• Cyclohexaneacetic acid, 3,3,5-trimethyl-, ethyl ester
• Ethyl 3,3,5-trimethylcyclohexaneacetate