CAS 3235-14-1

Z-Ala-Phe-OMe

Description:

Z-Ala-Phe-OMe, also known as Z-Ala-Phe methyl ester, is a dipeptide derivative characterized by the presence of a Z (benzyloxycarbonyl) protecting group on the amino group of alanine (Ala) and a phenylalanine (Phe) residue. This compound is typically used in peptide synthesis and research due to its stability and ability to protect the amino group during chemical reactions. The methyl ester group (OMe) enhances its solubility in organic solvents and can be hydrolyzed to release the corresponding carboxylic acid. Z-Ala-Phe-OMe exhibits properties typical of peptides, such as the ability to form hydrogen bonds and adopt specific conformations in solution. Its structure allows for potential applications in drug development, particularly in the design of peptide-based therapeutics. Additionally, the compound's CAS number, 3235-14-1, facilitates its identification in chemical databases and literature, aiding researchers in sourcing and studying this specific dipeptide derivative.

Formula: C₂₁H₂₄N₂O₅

InChI: InChI=1/C21H24N2O5/c1-15(22-21(26)28-14-17-11-7-4-8-12-17)19(24)23-18(20(25)27-2)13-16-9-5-3-6-10-16/h3-12,15,18H,13-14H2,1-2H3,(H,22,26)(H,23,24)

SMILES: CC(C(=NC(Cc1ccccc1)C(=O)OC)O)N=C(O)OCc1ccccc1

Synonyms:

• methyl N-[(benzyloxy)carbonyl]alanylphenylalaninate

Z-Ala-Phe-OMe

CAS: 3235-14-1

Z-Ala-Phe-OMe is a model amide that has been used to study the serine protease catalysed hydrolysis of peptides. This compound is a water molecule analogue that is immobilized on an ion exchange resin, which can be used as a support for experiments in catalysis and thermodynamics. Z-Ala-Phe-OMe has shown to be more efficient than other substrates and can be used to study kinetic data and thermodynamic properties.

Formula: C₂₁H₂₄N₂O₅

Purity: Min. 95%

Molecular weight: 384.43 g/mol

Ref: 3D-FA111441