CAS 3235-68-5
:1-Piperidineacetic acid, hydrochloride (1:1)
Description:
1-Piperidineacetic acid, hydrochloride (1:1), with the CAS number 3235-68-5, is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a carboxylic acid functional group, contributing to its acidic properties. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in water, making it useful in various applications, particularly in pharmaceuticals and organic synthesis. The presence of the piperidine moiety allows for potential interactions with biological systems, making it of interest in medicinal chemistry. Its properties include being a white to off-white solid, and it is generally stable under standard conditions. The compound may exhibit basicity due to the nitrogen atom in the piperidine ring, allowing it to participate in acid-base reactions. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken during use.
Formula:C7H13NO2·ClH
InChI:InChI=1S/C7H13NO2.ClH/c9-7(10)6-8-4-2-1-3-5-8;/h1-6H2,(H,9,10);1H
InChI key:InChIKey=WKVJGLBBPPFCGD-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1CCCCC1.Cl
Synonyms:- 1-Piperidineacetic acid, hydrochloride
- (Piperidin-1-yl)acetic acid hydrochloride
- 2-(Piperidin-1-yl)acetic acid hydrochloride
- 2-(1-Piperidino)acetic acid hydrochloride
- 1-Piperidineacetic acid, hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(piperidin-1-yl)acetic acid hydrochloride
CAS:Formula:C7H14ClNO2Purity:98%+;RGColor and Shape:SolidMolecular weight:179.64Piperidin-1-yl-acetic acid hydrochloride
CAS:Piperidin-1-yl-acetic acid hydrochloride is a labile, medicinal compound that is effective at low doses. It is used to treat hypercholesterolemia and inflammation. Piperidin-1-yl-acetic acid hydrochloride is an organic compound that belongs to the group of carboxylic acids. The molecule can exist in two different forms, which are called anomers: alpha and beta. The alpha form is more stable than the beta form and has higher medicinal properties. Piperidin-1-yl-acetic acid hydrochloride lowers cholesterol levels by inhibiting its synthesis.
Formula:C7H14ClNO2Purity:Min. 95%Molecular weight:179.64 g/mol(Piperidin-1-yl)acetic acid hydrochloride
CAS:(Piperidin-1-yl)acetic acid hydrochloridePurity:≥95%Molecular weight:179.64g/mol



