CAS 323580-73-0
:2-Benzofurancarboxylic acid, 6-chloro-, methyl ester
Description:
2-Benzofurancarboxylic acid, 6-chloro-, methyl ester is an organic compound characterized by its benzofuran structure, which consists of a fused benzene and furan ring. The presence of a carboxylic acid group and a methyl ester indicates that it can participate in various chemical reactions, such as esterification and hydrolysis. The chlorine substituent at the 6-position of the benzofuran ring can influence the compound's reactivity and polarity, potentially enhancing its biological activity or altering its solubility in different solvents. This compound may exhibit properties typical of both aromatic and heterocyclic compounds, including stability and potential for electrophilic substitution reactions. Its applications could span across pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. As with many chemical substances, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, the unique structural features of 2-Benzofurancarboxylic acid, 6-chloro-, methyl ester contribute to its potential utility in various chemical and industrial applications.
Formula:C10H7ClO3
InChI:InChI=1S/C10H7ClO3/c1-13-10(12)9-4-6-2-3-7(11)5-8(6)14-9/h2-5H,1H3
InChI key:InChIKey=BBKNMQLOVMQZRO-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC=2C(O1)=CC(Cl)=CC2
Synonyms:- Methyl 6-Chloro-2-benzofurancarboxylate
- 2-Benzofurancarboxylic acid, 6-chloro-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 6-chloro-1-benzofuran-2-carboxylate
CAS:Methyl 6-chloro-1-benzofuran-2-carboxylate
Molecular weight:210.61g/mol
