CymitQuimica logo

CAS 32364-72-0

:

[2,2'-Bithiophene]-5,5'-dicarboxaldehyde

Description:
[2,2'-Bithiophene]-5,5'-dicarboxaldehyde is an organic compound characterized by its bithiophene backbone, which consists of two thiophene rings connected by a single bond. This compound features two aldehyde functional groups located at the 5 and 5' positions of the bithiophene structure, making it a dicarboxaldehyde. The presence of the aldehyde groups contributes to its reactivity, allowing for various chemical transformations, such as condensation reactions and polymerization. The compound is typically a solid at room temperature and may exhibit properties such as solubility in organic solvents, which is common for thiophene derivatives. Its unique structure imparts interesting electronic properties, making it a candidate for applications in organic electronics, such as organic semiconductors and photovoltaic devices. Additionally, the compound can serve as a building block in the synthesis of more complex organic materials. Overall, [2,2'-Bithiophene]-5,5'-dicarboxaldehyde is notable for its potential in advanced material science and organic synthesis.
Formula:C10H6O2S2
InChI:InChI=1S/C10H6O2S2/c11-5-7-1-3-9(13-7)10-4-2-8(6-12)14-10/h1-6H
InChI key:RXAXZMANGDHIJX-UHFFFAOYSA-N
SMILES:C1=C(SC(=C1)C2=CC=C(S2)C=O)C=O
Synonyms:
  • 2,2'-Bithienyl-5,5'-dicarboxaldehyde
  • 2,2'-Bithiophene-5,5'-dialdehyde
  • 5,5'-Diformyl-2,2'-bithiophene
Found 5 products.