CAS 32365-02-9

4-amino-N-(4,5-dihydro-1,3-thiazol-2-yl)benzenesulfonamide

Description:

4-amino-N-(4,5-dihydro-1,3-thiazol-2-yl)benzenesulfonamide, with the CAS number 32365-02-9, is a chemical compound that features a sulfonamide functional group, which is characterized by the presence of a sulfonyl (SO2) moiety attached to an amine. This compound contains an amino group (-NH2) and a thiazole ring, contributing to its biological activity and potential pharmaceutical applications. The thiazole ring is a five-membered heterocyclic structure containing both sulfur and nitrogen, which can enhance the compound's reactivity and interaction with biological targets. The presence of the sulfonamide group suggests potential use in medicinal chemistry, particularly as an antibacterial agent, due to the historical efficacy of sulfonamides in treating bacterial infections. Additionally, the compound's solubility, stability, and reactivity can be influenced by its molecular structure, making it a subject of interest in drug development and research. Overall, this compound exemplifies the diverse functionalities that can be achieved through the combination of different chemical groups.

Formula: C₉H₁₁N₃O₂S₂

InChI: InChI=1/C9H11N3O2S2/c10-7-1-3-8(4-2-7)16(13,14)12-9-11-5-6-15-9/h1-4H,5-6,10H2,(H,11,12)

SMILES: c1cc(ccc1N)S(=O)(=O)NC1=NCCS1

Synonyms:

• Benzenesulfonamide, 4-amino-N-(4,5-dihydro-2-thiazolyl)-

4-Amino-N-(4,5-dihydro-thiazol-2-yl)-benzenesulfonamide

CAS: 32365-02-9

Formula: C₉H₁₁N₃O₂S₂

Molecular weight: 257.33

Ref: 10-F015533

4-Amino-N-(4,5-dihydro-1,3-thiazol-2-yl)benzene-1-sulfonamide

CAS: 32365-02-9

4-Amino-N-(4,5-dihydro-1,3-thiazol-2-yl)benzene-1-sulfonamide is a nitro compound that has been shown to have antitumor activity. It has been shown to inhibit the production of serotonin in the brain and its biological effects are thought to be related to its ability to block the activation of inflammatory cells by inhibiting the synthesis of arachidonic acid. This drug also has antiinflamatory and antiepileptic properties. 4ATBS inhibits adenosine receptor antagonists, which may be due to its ability to bind with these receptors and prevent them from binding with adenosine. This drug also has antioxidant properties due to its ability to scavenge free radicals. 4ATBS is currently being studied for use in cancer prevention and treatment as well as autoimmune diseases such as multiple sclerosis.

Formula: C₉H₁₁N₃O₂S₂

Purity: Min. 95%

Molecular weight: 257.3 g/mol

Ref: 3D-HBA36502