CAS 32365-53-0
:ethyl 5-formylfuran-3-carboxylate
Description:
Ethyl 5-formylfuran-3-carboxylate is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features a formyl group (-CHO) and an ethyl ester group (-COOEt) attached to the furan ring, contributing to its reactivity and potential applications in organic synthesis. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. Ethyl 5-formylfuran-3-carboxylate is known for its role in various chemical reactions, including condensation and cycloaddition reactions, making it valuable in the synthesis of more complex organic molecules. Its properties, such as solubility in organic solvents and stability under standard conditions, make it suitable for use in laboratory settings. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. As with many organic compounds, proper handling and safety precautions are essential due to potential hazards associated with its chemical nature.
Formula:C8H8O4
InChI:InChI=1/C8H8O4/c1-2-11-8(10)6-3-7(4-9)12-5-6/h3-5H,2H2,1H3
SMILES:CCOC(=O)c1cc(C=O)oc1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Ethyl 5-formylfuran-3-carboxylate
CAS:Ethyl 5-formylfuran-3-carboxylate is an organic compound that can be synthesized by the intramolecular Diels–Alder reaction of ethyl formate and isoindolone. The synthesis of this compound is efficient and can be carried out in a one pot process. Ethyl 5-formylfuran-3-carboxylate is a modulator that acts as an allosteric modulator of mGluR2. It has been shown to act as an allosteric modulator of the receptor, increasing its affinity for glutamate and enhancing its response to glutamate.Formula:C8H8O4Purity:Min. 95%Molecular weight:168.15 g/mol
