CAS 32366-63-5

2-(4-hydroxy-3-methoxyphenyl)quinoline-4-carboxylic acid

Description:

2-(4-Hydroxy-3-methoxyphenyl)quinoline-4-carboxylic acid, with the CAS number 32366-63-5, is an organic compound characterized by its complex structure, which includes a quinoline core substituted with a carboxylic acid group and a phenolic moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential solubility in polar solvents due to the presence of the carboxylic acid and hydroxyl groups. It may display biological activity, making it of interest in pharmaceutical research, particularly in the development of compounds with antimicrobial or anticancer properties. The presence of the methoxy group can influence its electronic properties and reactivity. Additionally, the compound may exhibit UV-Vis absorbance characteristics, which can be useful for analytical applications. Its synthesis often involves multi-step organic reactions, and it can be characterized using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity.

Formula: C₁₇H₁₃NO₄

InChI: InChI=1S/C17H13NO4/c1-22-16-8-10(6-7-15(16)19)14-9-12(17(20)21)11-4-2-3-5-13(11)18-14/h2-9,19H,1H3,(H,20,21)

InChI key: YDQQULBSEAGHCV-UHFFFAOYSA-N

SMILES: COC1=C(C=CC(=C1)C2=NC3=CC=CC=C3C(=C2)C(=O)O)O

Synonyms:

• 4-quinolinecarboxylic acid, 2-(4-hydroxy-3-methoxyphenyl)-
• 2-(4-hydroxy-3-methoxyphenyl)quinoline-4-carboxylic acid