CAS 3238-55-9
:2-Propionylpyridine
Description:
2-Propionylpyridine, with the CAS number 3238-55-9, is an organic compound that belongs to the class of pyridine derivatives. It features a pyridine ring substituted with a propionyl group at the 2-position, which contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid with a characteristic odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to the hydrophobic nature of the pyridine ring. 2-Propionylpyridine is known for its applications in the synthesis of various pharmaceuticals and agrochemicals, as well as in flavor and fragrance formulations. The presence of the carbonyl group in the propionyl moiety allows for reactivity in various chemical reactions, including condensation and acylation. Additionally, it exhibits biological activity, making it of interest in medicinal chemistry. Proper handling and storage are essential, as with many organic compounds, to ensure safety and stability.
Formula:C8H9NO
InChI:InChI=1S/C8H9NO/c1-2-8(10)7-5-3-4-6-9-7/h3-6H,2H2,1H3
InChI key:InChIKey=ZHAZHKPVEROFLH-UHFFFAOYSA-N
SMILES:C(CC)(=O)C1=CC=CC=N1
Synonyms:- 1-(2-Pyridinyl)-1-propanone
- 1-(Pyridin-2-yl)propan-1-one
- 1-Propanone, 1-(2-pyridinyl)-
- 1-Propanone, 1-(2-pyridyl)-
- 2-Propanoylpyridine
- 2-Pyridyl ethyl ketone
- Ethyl 2-pyridyl ketone
- 2-Propionylpyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Propionylpyridine
CAS:2-Propionylpyridine is a pyridine derivative widely used in biochemical experiments and drug synthesis research.Formula:C8H9NOPurity:97.46%Color and Shape:SolidMolecular weight:135.161-(Pyridin-2-yl)propan-1-one
CAS:1-(Pyridin-2-yl)propan-1-oneFormula:C8H9NOPurity:97%Color and Shape: pale-yellow liquidMolecular weight:135.16g/mol1-Pyridin-2-ylpropan-1-one
CAS:1-Pyridin-2-ylpropan-1-one is a synthetic compound with anti-tumor activity. It has been shown to inhibit the growth of bladder cancer cells in vitro and in vivo. The mechanism of action is unknown, but it may be due to its ability to scavenge hydroxyl radicals and prevent lipid peroxidation. 1-Pyridin-2-ylpropan-1-one has also been shown to inhibit the production of proinflammatory cytokines and chemokines in macrophages. This compound also has an ability to scavenge radical species such as nitric oxide and superoxide.
Formula:C8H9NOPurity:Min. 95%Molecular weight:135.16 g/mol




