CAS 32385-30-1

Propanoic acid, 3-(2-naphthalenylsulfonyl)-

Description:

Propanoic acid, 3-(2-naphthalenylsulfonyl)-, is an organic compound characterized by the presence of a propanoic acid functional group and a naphthalenesulfonyl moiety. This compound features a naphthalene ring, which is a polycyclic aromatic hydrocarbon, attached to a sulfonyl group (–SO2–), indicating its potential as a sulfonamide derivative. The presence of the propanoic acid group suggests that it has acidic properties, allowing it to donate protons in solution. This compound is likely to exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group, while the naphthalene component may contribute to hydrophobic interactions. Additionally, the sulfonyl group can enhance the compound's reactivity and may influence its biological activity, making it of interest in medicinal chemistry. Overall, this compound's unique structure may impart specific chemical and physical properties, including potential applications in pharmaceuticals or as a reagent in organic synthesis.

Formula: C₁₃H₁₂O₄S

InChI: InChI=1S/C13H12O4S/c14-13(15)7-8-18(16,17)12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9H,7-8H2,(H,14,15)

InChI key: OSYQPWIOAFNQLP-UHFFFAOYSA-N

SMILES: C1=CC=C2C=C(C=CC2=C1)S(=O)(=O)CCC(=O)O