CAS 32396-64-8
:4H-1-Benzopyran-4-one,7,8-dihydroxy-3-phenyl-
Description:
4H-1-Benzopyran-4-one, 7,8-dihydroxy-3-phenyl-, also known as a flavonoid compound, exhibits several notable characteristics. This compound features a benzopyran core structure, which is typical of flavonoids, and is characterized by the presence of hydroxyl groups at the 7 and 8 positions, contributing to its potential antioxidant properties. The phenyl group at the 3 position enhances its chemical reactivity and may influence its biological activity. This compound is often studied for its potential health benefits, including anti-inflammatory and anticancer properties, attributed to its ability to scavenge free radicals and modulate various signaling pathways. Its solubility and stability can vary depending on the solvent and environmental conditions, which is important for its applications in pharmaceuticals and nutraceuticals. Additionally, the presence of multiple functional groups allows for diverse interactions with biological molecules, making it a subject of interest in medicinal chemistry and natural product research.
Formula:C15H10O4
InChI:InChI=1S/C15H10O4/c16-12-7-6-10-13(17)11(8-19-15(10)14(12)18)9-4-2-1-3-5-9/h1-8,16,18H
InChI key:HNPAPWSBQJTTPD-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=COC3=C(C2=O)C=CC(=C3O)O
Synonyms:- Isoflavone,7,8-dihydroxy- (7CI,8CI)
- 7,8-Dihydroxyisoflavone
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery