CAS 324-41-4
:2-Bromo-6-fluoronaphthalene
Description:
2-Bromo-6-fluoronaphthalene is an organic compound characterized by its structure, which consists of a naphthalene ring substituted with a bromine atom at the second position and a fluorine atom at the sixth position. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its aromatic properties, which contribute to its stability and reactivity. The presence of both bromine and fluorine introduces unique electronic effects, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. 2-Bromo-6-fluoronaphthalene is generally insoluble in water but soluble in organic solvents, which is typical for halogenated aromatic compounds. Safety precautions should be taken when handling this substance, as it may pose health risks through inhalation or skin contact. Its chemical behavior can be influenced by the presence of the halogen substituents, which can participate in various reactions, including nucleophilic substitutions and coupling reactions.
Formula:C10H6BrF
InChI:InChI=1/C10H6BrF/c11-9-3-1-8-6-10(12)4-2-7(8)5-9/h1-6H
SMILES:c1cc(cc2ccc(cc12)F)Br
Synonyms:- 3-Pyridinesulfonic Acid, 6-Methyl-
- 6-Methyl-3-pyridinesulfonic acid
- 2-Fluoro-6-Bromonaphthalene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Bromo-6-fluoronaphthalene
CAS:Formula:C10H6BrFPurity:>97.0%(GC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:225.062-Bromo-6-fluoronaphthalene
CAS:Formula:C10H6BrFPurity:98%Color and Shape:SolidMolecular weight:225.05702-Bromo-6-fluoronaphthalene
CAS:2-Bromo-6-fluoronaphthaleneFormula:C10H6BrFPurity:98%Color and Shape: faint to pale yellow crystalline solidMolecular weight:225.06g/mol2-Bromo-6-fluoronaphthalene
CAS:Formula:C10H6BrFPurity:97%Color and Shape:White powderMolecular weight:225.062-bromo-6-fluoronaphthalene
CAS:<p>2-bromo-6-fluoronaphthalene is a molecule that has been shown to be a good electron donor in organic solar cells. It is also an analgesic and antinociceptive agent. 2-Bromo-6-fluoronaphthalene has shown to have antiinflammatory effects and inhibit the production of prostaglandins, which are chemical messengers that induce inflammation. The molecular structure of 2-bromo-6-fluoronaphthalene consists of two bromine atoms attached to two naphthalene rings. The bromine atoms provide strong electron donating properties and the naphthalene rings provide stability for the molecule.</p>Formula:C10H6BrFPurity:Min. 95%Molecular weight:225.06 g/mol




