CAS 3240-10-6

3-(4-chlorophenyl)prop-2-ynoic acid

Description:

3-(4-Chlorophenyl)prop-2-ynoic acid, also known by its CAS number 3240-10-6, is an organic compound characterized by its unique structure, which includes a propyne moiety and a chlorophenyl group. This compound features a triple bond between the second and third carbon atoms of the propynoic acid chain, contributing to its reactivity and potential applications in organic synthesis. The presence of the 4-chlorophenyl group enhances its lipophilicity and may influence its biological activity. As a carboxylic acid, it exhibits acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The compound is of interest in medicinal chemistry and materials science due to its potential as a building block for more complex molecules. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. Overall, 3-(4-chlorophenyl)prop-2-ynoic acid is a versatile compound with significant implications in chemical research and applications.

Formula: C₉H₅ClO₂

InChI: InChI=1/C9H5ClO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-2,4-5H,(H,11,12)

SMILES: c1cc(ccc1C#CC(=O)O)Cl

Propiolic acid, (p-chlorophenyl)- (8CI)

CAS: 3240-10-6

Formula: C₉H₅ClO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 180.5878

Ref: IN-DA00CIRE

3-(4-Chlorophenyl)propiolic acid

CAS: 3240-10-6

3-(4-Chlorophenyl)propiolic acid

Purity: 98%

Molecular weight: 180.59g/mol

Ref: 54-OR930388

3-(4-Chlorophenyl)propiolic Acid

CAS: 3240-10-6

Formula: C₉H₅ClO₂

Purity: >98.0%(GC)

Color and Shape: White to Light yellow to Light orange powder to crystal

Molecular weight: 180.59

Ref: 3B-C3314

3-(4-Chlorophenyl)propiolic acid

CAS: 3240-10-6

Formula: C₉H₅ClO₂

Purity: 98%

Molecular weight: 180.59

Ref: 10-F223333