CAS 324002-02-0

Benzoic acid,4-(aminoiminomethyl)-2-fluoro-

Description:

Benzoic acid, 4-(aminoiminomethyl)-2-fluoro-, is a chemical compound characterized by its benzoic acid structure modified with an aminoiminomethyl group and a fluorine atom at the 2-position of the aromatic ring. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid group and the amino group. It is likely to be a solid at room temperature, with potential solubility in polar solvents due to the presence of the carboxylic acid and amino groups. The fluorine substitution can influence its reactivity and polarity, potentially enhancing its biological activity or interaction with other molecules. As with many benzoic acid derivatives, it may exhibit antimicrobial or antifungal properties, making it of interest in pharmaceutical and agricultural applications. Safety data should be consulted for handling and usage, as the presence of fluorine and amino groups can affect toxicity and environmental impact.

Formula: C₈H₇FN₂O₂

InChI: InChI=1S/C8H7FN2O2/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-3H,(H3,10,11)(H,12,13)

InChI key: KDIIYJQRFVKANU-UHFFFAOYSA-N

SMILES: C1=CC(=C(C=C1C(=N)N)F)C(=O)O

Synonyms:

• 4-Amidino-2-fluorobenzoicacid