CAS 324008-94-8

1,4-Bis(3-chlorophenyl)-1H-pyrazol-5-amine

Description:

1,4-Bis(3-chlorophenyl)-1H-pyrazol-5-amine is an organic compound characterized by its pyrazole core, which is substituted at the 1 and 4 positions with 3-chlorophenyl groups. This compound typically exhibits properties associated with pyrazole derivatives, such as potential biological activity, making it of interest in medicinal chemistry. The presence of chlorine atoms on the phenyl rings can influence its electronic properties and reactivity, potentially enhancing its lipophilicity and biological interactions. The compound may be utilized in various applications, including as a building block in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure suggests it may engage in hydrogen bonding and other intermolecular interactions, which can affect its solubility and stability in different solvents. As with many pyrazole derivatives, it may also exhibit interesting pharmacological properties, warranting further investigation into its potential therapeutic uses. Safety and handling precautions should be observed due to the presence of chlorine, which can pose health risks.

Formula: C₁₅H₁₁Cl₂N₃

InChI: InChI=1S/C15H11Cl2N3/c16-11-4-1-3-10(7-11)14-9-19-20(15(14)18)13-6-2-5-12(17)8-13/h1-9H,18H2

InChI key: InChIKey=ROMZLARUZRGGJA-UHFFFAOYSA-N

SMILES: NC1=C(C=NN1C2=CC(Cl)=CC=C2)C3=CC(Cl)=CC=C3

Synonyms:

• 1,4-Bis(3-chlorophenyl)-1H-pyrazol-5-amine
• 1H-Pyrazol-5-amine, 1,4-bis(3-chlorophenyl)-