CAS 324018-62-4

1,3,5-Triazin-2(1H)-one,4-amino-1-(3,5-di-O-benzoyl-2-deoxy-b-L-threo-pentofuranosyl)-

Description:

1,3,5-Triazin-2(1H)-one, 4-amino-1-(3,5-di-O-benzoyl-2-deoxy-b-L-threo-pentofuranosyl)-, identified by CAS number 324018-62-4, is a complex organic compound featuring a triazine ring and a modified sugar moiety. The triazine structure contributes to its potential as a heterocyclic compound, which may exhibit various biological activities. The presence of the amino group enhances its reactivity and potential for forming hydrogen bonds, while the benzoyl groups attached to the sugar moiety can influence its solubility and stability. This compound is likely to be of interest in medicinal chemistry and biochemistry due to its structural features, which may facilitate interactions with biological targets. Its synthesis and characterization would involve standard organic chemistry techniques, and its properties could be explored through various analytical methods, including NMR, mass spectrometry, and chromatography. Overall, this compound exemplifies the intersection of carbohydrate chemistry and heterocyclic chemistry, potentially leading to applications in drug development or as a biochemical probe.

Formula: C₂₂H₂₀N₄O₆

InChI: InChI=1S/C22H20N4O6/c23-21-24-13-26(22(29)25-21)18-11-16(32-20(28)15-9-5-2-6-10-15)17(31-18)12-30-19(27)14-7-3-1-4-8-14/h1-10,13,16-18H,11-12H2,(H2,23,25,29)/t16-,17-,18-/m0/s1

InChI key: BYBDEADADFZSJF-BZSNNMDCSA-N

SMILES: C1[C@@H]([C@@H](O[C@@H]1N2C=NC(=NC2=O)N)COC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4