CymitQuimica logo

CAS 32403-69-3

:

[(2,4-dinitrophenyl)sulfanyl]acetic acid

Description:
[(2,4-Dinitrophenyl)sulfanyl]acetic acid is an organic compound characterized by the presence of a dinitrophenyl group and a thiol (sulfanyl) functional group attached to an acetic acid moiety. This compound typically exhibits a yellow crystalline appearance due to the dinitrophenyl substituent, which is known for its strong electron-withdrawing properties. The presence of the sulfanyl group introduces a thiol functionality, which can participate in various chemical reactions, including nucleophilic substitutions and redox reactions. The acetic acid portion contributes to the compound's acidity, allowing it to act as a weak acid in solution. This compound is often used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its reactivity and ability to form derivatives. Additionally, the dinitrophenyl group is commonly employed in the synthesis of dyes and as a labeling agent in biochemical assays. Safety precautions should be observed when handling this compound, as dinitrophenyl derivatives can be hazardous and potentially explosive under certain conditions.
Formula:C8H6N2O6S
InChI:InChI=1/C8H6N2O6S/c11-8(12)4-17-7-2-1-5(9(13)14)3-6(7)10(15)16/h1-3H,4H2,(H,11,12)
SMILES:c1cc(c(cc1N(=O)=O)N(=O)=O)SCC(=O)O
Synonyms:
  • Acetic Acid, 2-[(2,4-Dinitrophenyl)Thio]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.