CAS 32404-28-7
:3-acetyl-L-tyrosine
Description:
3-Acetyl-L-tyrosine is a derivative of the amino acid L-tyrosine, characterized by the presence of an acetyl group at the 3-position of the aromatic ring. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. It is known for its role in biochemical processes, particularly in the synthesis of neurotransmitters and as a precursor to various bioactive compounds. The acetylation enhances its stability and bioavailability compared to L-tyrosine. In terms of its chemical properties, 3-acetyl-L-tyrosine exhibits both acidic and basic characteristics due to the presence of the amino and carboxyl groups, allowing it to participate in various chemical reactions. It is often used in research and pharmaceutical applications, particularly in studies related to neurochemistry and metabolic pathways. Additionally, it may have potential applications in dietary supplements aimed at enhancing cognitive function and mood.
Formula:C11H13NO4
InChI:InChI=1/C11H13NO4/c1-6(13)8-4-7(2-3-10(8)14)5-9(12)11(15)16/h2-4,9,14H,5,12H2,1H3,(H,15,16)/t9-/m0/s1
SMILES:CC(=O)c1cc(ccc1O)C[C@@H](C(=O)O)N
Synonyms:- L-tyrosine, 3-acetyl-
- Tyrosine,3-acetyl-, L-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(S)-3-(3-acetyl-4-hydroxyphenyl)-2-aminopropanoic acid hydrochloride
CAS:(S)-3-(3-acetyl-4-hydroxyphenyl)-2-aminopropanoic acid hydrochloridePurity:95%Molecular weight:259.69g/mol3-Acetyl-L-tyrosine Hydrochloride
CAS:Controlled ProductApplications 3-Acetyl-L-tyrosine is an acetylated L-Tyrosine derivative. 3-Acetyl-L-tyrosine can potentially be used in the preparation and modification of non-natural protein containing non-natural amino acids. An impurity of Levodopa (D533751).
References Tamilarasu, N. et al.: BIconj. Chem., 12, 135 (2001); Song, Y.-L. et al.: J. Med. Chem., 49, 1585 (2006);Formula:C11H14ClNO4Color and Shape:Off-White To Light BrownMolecular weight:259.69(S)-3-(3-acetyl-4-hydroxyphenyl)-2-aminopropanoic acid hydrochloride
CAS:Purity:95%Molecular weight:259.69000243-Acetyl-L-tyrosinehydrochloride
CAS:3-Acetyl-L-tyrosinehydrochloride is a synthetic compound that has been used as a starting material for the synthesis of other compounds. It is an ester of 3-acetyltryptophan and L-tyrosine. The optical antipode of this compound was synthesized in 1983, although it has not been studied extensively. The yield of 3-acetyltyrosine hydrochloride is about 45%. The product can be purified by crystallization from water or acetone and recrystallization from benzene or ether. The reaction with benzaldehyde produces 3-(2,4-dihydroxyphenyl)propionic acid ethyl ester (1). This reaction also produces pyrrolidine (2), which is the key intermediate for the synthesis of lysergic acid diethylamide (LSD).Formula:C11H14ClNO4Purity:Min. 95%Molecular weight:259.69 g/mol




