CAS 324054-76-4

2-[[5-(3-Bromophenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]thio]acetic acid hydrazide

Description:

2-[[5-(3-Bromophenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]thio]acetic acid hydrazide is a chemical compound characterized by its complex structure, which includes a triazole ring, a bromophenyl group, and a hydrazide functional group. This compound is typically recognized for its potential biological activity, particularly in the field of medicinal chemistry, where it may exhibit antimicrobial or antifungal properties. The presence of the triazole moiety is significant, as triazoles are known for their ability to interact with biological targets, making them valuable in drug development. Additionally, the hydrazide functional group can participate in various chemical reactions, enhancing the compound's versatility. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, this compound represents a class of heterocyclic compounds that are of interest for their potential therapeutic applications and chemical reactivity.

Formula: C₁₆H₁₄BrN₅OS

InChI: InChI=1S/C16H14BrN5OS/c17-12-6-4-5-11(9-12)15-20-21-16(24-10-14(23)19-18)22(15)13-7-2-1-3-8-13/h1-9H,10,18H2,(H,19,23)

InChI key: InChIKey=ZHHCMWHDOHWEDJ-UHFFFAOYSA-N

SMILES: S(CC(NN)=O)C=1N(C(=NN1)C2=CC(Br)=CC=C2)C3=CC=CC=C3

Synonyms:

• Acetic acid, 2-[[5-(3-bromophenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]thio]-, hydrazide
• Acetic acid, [[5-(3-bromophenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]thio]-, hydrazide
• 2-[[5-(3-Bromophenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]thio]acetic acid hydrazide