CAS 324073-86-1

Acetamide, 2-phenoxy-N-[(tetrahydro-2-furanyl)methyl]-

Description:

Acetamide, 2-phenoxy-N-[(tetrahydro-2-furanyl)methyl]- is an organic compound characterized by its amide functional group, which is derived from acetic acid. This compound features a phenoxy group, indicating the presence of a phenol derivative, and a tetrahydro-2-furanyl moiety, which contributes to its cyclic structure and potential reactivity. The presence of the tetrahydrofuran ring suggests that it may exhibit unique solubility and stability properties. Generally, compounds of this nature can be involved in various chemical reactions, including nucleophilic substitutions and acylation processes. The molecular structure implies potential applications in pharmaceuticals or agrochemicals, where such compounds may serve as intermediates or active ingredients. Additionally, the presence of both aromatic and aliphatic components may influence its physical properties, such as melting point, boiling point, and solubility in different solvents. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.

Formula: C₁₃H₁₇NO₃

InChI: InChI=1S/C13H17NO3/c15-13(14-9-12-7-4-8-16-12)10-17-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H,14,15)

InChI key: TZSZZYGHGXEJTC-UHFFFAOYSA-N

SMILES: C1CC(OC1)CNC(=O)COC2=CC=CC=C2