CAS 3241-76-7

N-(3,4-dimethoxybenzyl)-2-phenylethanamine

Description:

N-(3,4-dimethoxybenzyl)-2-phenylethanamine, with the CAS number 3241-76-7, is an organic compound that belongs to the class of phenylethylamines. This substance features a phenylethylamine backbone, characterized by an ethylamine group attached to a phenyl ring, along with a benzyl moiety that is substituted with two methoxy groups at the 3 and 4 positions. The presence of these methoxy groups enhances the compound's lipophilicity and may influence its biological activity. Typically, compounds of this class can exhibit a range of pharmacological effects, including potential stimulant or psychoactive properties, depending on their specific structure and substituents. The compound's molecular structure suggests it may interact with various neurotransmitter systems, although specific biological activities would require empirical investigation. Additionally, its solubility, stability, and reactivity can be influenced by the methoxy substitutions, making it of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₇H₂₁NO₂

InChI: InChI=1/C17H21NO2/c1-19-16-9-8-15(12-17(16)20-2)13-18-11-10-14-6-4-3-5-7-14/h3-9,12,18H,10-11,13H2,1-2H3

InChI key: CKFVAYWLHADYJV-UHFFFAOYSA-N

SMILES: COc1ccc(cc1OC)CNCCc1ccccc1

Synonyms:

• (3,4-Dimethoxy-benzyl)-phenethyl-amine
• benzeneethanamine, N-[(3,4-dimethoxyphenyl)methyl]-