CAS 32415-45-5

N-[(5-Acetyl-2-thienyl)methyl]acetamide

Description:

N-[(5-Acetyl-2-thienyl)methyl]acetamide is an organic compound characterized by its thienyl and acetamide functional groups. It features a thienyl ring, which is a five-membered aromatic ring containing sulfur, contributing to its unique chemical properties. The presence of the acetyl group enhances its reactivity and solubility in organic solvents. This compound typically exhibits moderate polarity due to the combination of the polar acetamide group and the less polar thienyl moiety. It may participate in various chemical reactions, including acylation and nucleophilic substitutions, making it of interest in synthetic organic chemistry. Additionally, its structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation. The compound is likely to be stable under standard laboratory conditions, but like many organic compounds, it should be handled with care, following appropriate safety protocols. Overall, N-[(5-Acetyl-2-thienyl)methyl]acetamide represents a versatile structure with potential utility in various chemical applications.

Formula: C₉H₁₁NO₂S

InChI: InChI=1S/C9H11NO2S/c1-6(11)9-4-3-8(13-9)5-10-7(2)12/h3-4H,5H2,1-2H3,(H,10,12)

InChI key: InChIKey=UDCCRNVIUZAEHV-UHFFFAOYSA-N

SMILES: C(NC(C)=O)C=1SC(C(C)=O)=CC1

Synonyms:

• N-[(5-Acetyl-2-thienyl)methyl]acetamide
• Acetamide, N-(5-acetyl-2-thenyl)-
• Acetamide, N-[(5-acetyl-2-thienyl)methyl]-

N-[(5-Acetylthiophen-2-yl)methyl]acetamide

CAS: 32415-45-5

Versatile small molecule scaffold

Formula: C₉H₁₁NO₂S

Purity: Min. 95%

Molecular weight: 197.26 g/mol

Ref: 3D-HBA41545