CAS 32420-91-0

Thiourea,N-propyl-N'-4-pyridinyl-

Description:

Thiourea, N-propyl-N'-4-pyridinyl- (CAS 32420-91-0) is an organic compound characterized by its thiourea functional group, which consists of a carbon atom double-bonded to sulfur and single-bonded to two nitrogen atoms. This compound features a propyl group and a pyridine ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the pyridine nitrogen, which can engage in hydrogen bonding. The compound may display biological activity, making it of interest in pharmaceutical and agricultural applications. Its reactivity can be influenced by the electron-donating properties of the propyl group and the electron-withdrawing nature of the pyridine ring. As with many thioureas, it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Safety data should be consulted, as thioureas can have toxicological implications. Overall, this compound's structure and functional groups make it a versatile candidate for further research and application in various fields.

Formula: C₉H₁₃N₃S

InChI: InChI=1S/C9H13N3S/c1-2-5-11-9(13)12-8-3-6-10-7-4-8/h3-4,6-7H,2,5H2,1H3,(H2,10,11,12,13)

InChI key: MPJMIZAPJTXMLK-UHFFFAOYSA-N

SMILES: CCCNC(=S)NC1=CC=NC=C1

Synonyms:

• Urea,1-propyl-3-(4-pyridyl)-2-thio- (8CI)