CAS 32427-82-0
:1-(5-chlorothiophen-2-yl)propan-1-one
Description:
1-(5-Chlorothiophen-2-yl)propan-1-one, with the CAS number 32427-82-0, is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. The presence of a chlorine atom at the 5-position of the thiophene ring contributes to its reactivity and potential applications in various chemical reactions. The propan-1-one moiety indicates that this compound features a ketone functional group, which is known for its carbonyl functionality that can participate in nucleophilic addition reactions. This compound may exhibit properties typical of both thiophenes and ketones, such as moderate solubility in organic solvents and potential biological activity. Its unique structure makes it of interest in fields such as medicinal chemistry and materials science, where it may serve as a building block for synthesizing more complex molecules or as a precursor in the development of pharmaceuticals. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C7H7ClOS
InChI:InChI=1/C7H7ClOS/c1-2-5(9)6-3-4-7(8)10-6/h3-4H,2H2,1H3
SMILES:CCC(=O)c1ccc(Cl)s1
Synonyms:- 1-(5-Chloro-2-thienyl)propan-1-one
- 1-Propanone, 1-(5-Chloro-2-Thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
