CAS 32428-76-5

2-Bromo-N-(2,6-dibromophenyl)acetamide

Description:

2-Bromo-N-(2,6-dibromophenyl)acetamide is an organic compound characterized by its brominated aromatic structure and amide functional group. It features a bromine atom attached to the second carbon of the acetamide moiety, as well as two bromine substituents on the phenyl ring, specifically at the 2 and 6 positions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic aromatic components. The presence of multiple bromine atoms contributes to its potential biological activity, including antimicrobial or anticancer properties, making it of interest in medicinal chemistry. Additionally, the compound's structure suggests it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, due to the reactivity of the bromine substituents. Safety precautions should be taken when handling this compound, as brominated compounds can be hazardous. Overall, 2-Bromo-N-(2,6-dibromophenyl)acetamide is a notable example of a halogenated amide with potential applications in research and industry.

Formula: C₈H₆Br₃NO

InChI: InChI=1S/C8H6Br3NO/c9-4-7(13)12-8-5(10)2-1-3-6(8)11/h1-3H,4H2,(H,12,13)

InChI key: InChIKey=QEBXNFRYOWSPNW-UHFFFAOYSA-N

SMILES: N(C(CBr)=O)C1=C(Br)C=CC=C1Br

Synonyms:

• Acetanilide, 2,2′,6′-tribromo-
• 2-Bromo-2′,6′-dibromoacetanilide
• Acetamide, 2-bromo-N-(2,6-dibromophenyl)-
• 2-Bromo-N-(2,6-dibromophenyl)acetamide