CAS 3243-24-1

1,5-dihydro-4H-imidazo[4,5-c]pyridin-4-one

Description:

1,5-Dihydro-4H-imidazo[4,5-c]pyridin-4-one is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings. This compound features a bicyclic structure that contributes to its unique chemical properties. It typically exhibits a solid state at room temperature and is soluble in polar solvents, which is common for many nitrogen-containing heterocycles. The presence of the carbonyl group in the imidazole ring enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and cycloadditions. Additionally, this compound may exhibit biological activity, which has drawn interest in medicinal chemistry for potential pharmaceutical applications. Its molecular structure allows for various functionalizations, making it versatile in synthetic chemistry. Overall, 1,5-dihydro-4H-imidazo[4,5-c]pyridin-4-one is notable for its structural complexity and potential utility in both research and industrial applications.

Formula: C₆H₅N₃O

InChI: InChI=1/C6H5N3O/c10-6-5-4(1-2-7-6)8-3-9-5/h1-3H,(H,7,10)(H,8,9)

SMILES: c1cnc(c2c1nc[nH]2)O

1H-Imidazo[4,5-c]pyridin-4-ol

CAS: 3243-24-1

Formula: C₆H₅N₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 135.1234

Ref: IN-DA007G5G

1H-Imidazo[4,5-c]pyridin-4-ol

CAS: 3243-24-1

1H-Imidazo[4,5-c]pyridin-4-ol

Purity: 97%

Molecular weight: 135.13g/mol

Ref: 54-OR1033884

1H-Imidazo[4,5-c]pyridin-4-ol

CAS: 3243-24-1

Formula: C₆H₅N₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 135.126

Ref: 10-F331062

4H-Imidazo[4,5-c]pyridin-4-one

CAS: 3243-24-1

4H-Imidazo[4,5-c]pyridin-4-one is a water soluble compound that is soluble in water. It is a sulphonic acid that can be found in acid salts and deazaguanine. 4H-Imidazo[4,5-c]pyridin-4-one is used as a pharmaceutical dosage.

Formula: C₆H₃N₃O

Purity: Min. 95%

Molecular weight: 133.11 g/mol

Ref: 3D-DAA24324