CAS 32433-28-6
:N-(quinolin-4-yl)acetamide
Description:
N-(quinolin-4-yl)acetamide is an organic compound characterized by its quinoline moiety, which contributes to its aromatic properties and potential biological activity. The structure features a quinoline ring substituted with an acetamide group, which enhances its solubility and reactivity. This compound typically exhibits moderate polarity due to the presence of both hydrophobic (quinoline) and hydrophilic (acetamide) functional groups. It may display various chemical properties, including the ability to participate in hydrogen bonding, making it of interest in medicinal chemistry for potential pharmaceutical applications. The compound's molecular interactions can be influenced by the presence of the nitrogen atom in the quinoline ring, which can act as a hydrogen bond acceptor. Additionally, N-(quinolin-4-yl)acetamide may exhibit biological activities, such as antimicrobial or anticancer properties, which are common in compounds containing quinoline derivatives. Its synthesis often involves straightforward organic reactions, making it accessible for research and development in various chemical and pharmaceutical contexts.
Formula:C11H10N2O
InChI:InChI=1/C11H10N2O/c1-8(14)13-11-6-7-12-10-5-3-2-4-9(10)11/h2-7H,1H3,(H,12,13,14)
SMILES:CC(=O)N=c1cc[nH]c2ccccc12
Synonyms:- acetamide, N-4-quinolinyl-
- N-(Quinolin-4-yl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
